C52H42O7 — CID 118652597
1-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-(1-prop-2-enoyloxyethenoxy)dibenzofuran-3-yl]oxyethyl prop-2-enoate (PubChem CID 118652597) has the molecular formula C52H42O7 and a molecular weight of 778.90 g/mol. Its IUPAC name is 1-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-(1-prop-2-enoyloxyethenoxy)dibenzofuran-3-yl]oxyethyl prop-2-enoate.
| Compound Name | 1-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-(1-prop-2-enoyloxyethenoxy)dibenzofuran-3-yl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 118652597 |
| Molecular Formula | C52H42O7 |
| Molecular Weight | 778.90 g/mol |
| Exact Mass | 778.29 |
| IUPAC Name | 1-[2,8-bis(9,9-dimethylfluoren-2-yl)-7-(1-prop-2-enoyloxyethenoxy)dibenzofuran-3-yl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(=C)Oc1cc2oc3cc(OC(C)OC(=O)C=C)c(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc3c2cc1-c1ccc2c(c1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C52H42O7/c1-9-49(53)57-29(3)55-45-27-47-39(25-37(45)31-19-21-35-33-15-11-13-17-41(33)51(5,6)43(35)23-31)40-26-38(46(28-48(40)59-47)56-30(4)58-50(54)10-2)32-20-22-36-34-16-12-14-18-42(34)52(7,8)44(36)24-32/h9-28,30H,1-3H2,4-8H3 |
| InChIKey | YLSCCZIZONEKBE-UHFFFAOYSA-N |
| XLogP | 12.57 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.90 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|