C18H26FN5O2S — CID 90405998
4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-pentylpyrrolidin-3-amine (PubChem CID 90405998) has the molecular formula C18H26FN5O2S and a molecular weight of 395.50 g/mol. Its IUPAC name is 4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-pentylpyrrolidin-3-amine.
| Compound Name | 4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-pentylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 90405998 |
| Molecular Formula | C18H26FN5O2S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-(3-fluoro-2-pyridinyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-pentylpyrrolidin-3-amine |
| SMILES | CCCCCNC1CN(S(=O)(=O)c2cn(C)cn2)CC1c1ncccc1F |
| InChI | InChI=1S/C18H26FN5O2S/c1-3-4-5-8-20-16-11-24(27(25,26)17-12-23(2)13-22-17)10-14(16)18-15(19)7-6-9-21-18/h6-7,9,12-14,16,20H,3-5,8,10-11H2,1-2H3 |
| InChIKey | GXEVNCHDWVMUFR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|