C8H18O6S2 — CID 90415242
2-(2,3-dimethylbutan-2-yloxysulfonyl)ethanesulfonic acid (PubChem CID 90415242) has the molecular formula C8H18O6S2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(2,3-dimethylbutan-2-yloxysulfonyl)ethanesulfonic acid.
| Compound Name | 2-(2,3-dimethylbutan-2-yloxysulfonyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 90415242 |
| Molecular Formula | C8H18O6S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(2,3-dimethylbutan-2-yloxysulfonyl)ethanesulfonic acid |
| SMILES | CC(C)C(C)(C)OS(=O)(=O)CCS(=O)(=O)O |
| InChI | InChI=1S/C8H18O6S2/c1-7(2)8(3,4)14-16(12,13)6-5-15(9,10)11/h7H,5-6H2,1-4H3,(H,9,10,11) |
| InChIKey | ZWWJBNMNNHFAGI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|