C27H24ClFN2O2 — CID 90418988
[4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-(2-fluoro-2H-quinolin-1-yl)phenyl]methanone (PubChem CID 90418988) has the molecular formula C27H24ClFN2O2 and a molecular weight of 462.95 g/mol. Its IUPAC name is [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-(2-fluoro-2H-quinolin-1-yl)phenyl]methanone.
| Compound Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-(2-fluoro-2H-quinolin-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 90418988 |
| Molecular Formula | C27H24ClFN2O2 |
| Molecular Weight | 462.95 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [4-(2-chlorophenyl)-4-hydroxypiperidin-1-yl]-[4-(2-fluoro-2H-quinolin-1-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(N2c3ccccc3C=CC2F)cc1)N1CCC(O)(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C27H24ClFN2O2/c28-23-7-3-2-6-22(23)27(33)15-17-30(18-16-27)26(32)20-9-12-21(13-10-20)31-24-8-4-1-5-19(24)11-14-25(31)29/h1-14,25,33H,15-18H2 |
| InChIKey | KXEBYFSHVRFNFC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.95 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|