About 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine
6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 90421687) has the molecular formula C11H9N5O2S
and a molecular weight of 275.29 g/mol. Its IUPAC name is 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 90421687 |
| Molecular Formula | C11H9N5O2S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | O=S(O)Nc1ccc(-c2ncc3cn[nH]c3n2)cc1 |
| InChI | InChI=1S/C11H9N5O2S/c17-19(18)16-9-3-1-7(2-4-9)10-12-5-8-6-13-15-11(8)14-10/h1-6,16H,(H,17,18)(H,12,13,14,15) |
| InChIKey | YSCSWZJUVIIHLZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine (CID 90421687) is 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine is O=S(O)Nc1ccc(-c2ncc3cn[nH]c3n2)cc1.
What is the InChIKey of 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is YSCSWZJUVIIHLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N5O2S/c17-19(18)16-9-3-1-7(2-4-9)10-12-5-8-6-13-15-11(8)14-10/h1-6,16H,(H,17,18)(H,12,13,14,15).
What are the key properties of 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine?
6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 275.29 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-(sulfinoamino)phenyl]-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 90421687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).