C14H9F4NO4S — CID 91213775
2,2,3,3-tetrafluoro-6-[4-(sulfinoamino)phenyl]-1,4-benzodioxine (PubChem CID 91213775) has the molecular formula C14H9F4NO4S and a molecular weight of 363.29 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-6-[4-(sulfinoamino)phenyl]-1,4-benzodioxine.
| Compound Name | 2,2,3,3-tetrafluoro-6-[4-(sulfinoamino)phenyl]-1,4-benzodioxine |
|---|---|
| PubChem CID | 91213775 |
| Molecular Formula | C14H9F4NO4S |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 2,2,3,3-tetrafluoro-6-[4-(sulfinoamino)phenyl]-1,4-benzodioxine |
| SMILES | O=S(O)Nc1ccc(-c2ccc3c(c2)OC(F)(F)C(F)(F)O3)cc1 |
| InChI | InChI=1S/C14H9F4NO4S/c15-13(16)14(17,18)23-12-7-9(3-6-11(12)22-13)8-1-4-10(5-2-8)19-24(20)21/h1-7,19H,(H,20,21) |
| InChIKey | IICWIYLZOUCJPN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|