C17H16FIO3 — CID 90423072
3,5-diethoxy-4-(4-fluorophenyl)-2-iodobenzaldehyde (PubChem CID 90423072) has the molecular formula C17H16FIO3 and a molecular weight of 414.21 g/mol. Its IUPAC name is 3,5-diethoxy-4-(4-fluorophenyl)-2-iodobenzaldehyde.
| Compound Name | 3,5-diethoxy-4-(4-fluorophenyl)-2-iodobenzaldehyde |
|---|---|
| PubChem CID | 90423072 |
| Molecular Formula | C17H16FIO3 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 3,5-diethoxy-4-(4-fluorophenyl)-2-iodobenzaldehyde |
| SMILES | CCOc1cc(C=O)c(I)c(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FIO3/c1-3-21-14-9-12(10-20)16(19)17(22-4-2)15(14)11-5-7-13(18)8-6-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | AAFAXYMBGJZYMZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|