C24H32N2O9 — CID 90424228
methyl 5-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-5-oxo-2-[[(2E,4E)-5-phenylpenta-2,4-dienoyl]amino]pentanoate (PubChem CID 90424228) has the molecular formula C24H32N2O9 and a molecular weight of 492.53 g/mol. Its IUPAC name is methyl 5-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-5-oxo-2-[[(2E,4E)-5-phenylpenta-2,4-dienoyl]amino]pentanoate.
| Compound Name | methyl 5-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-5-oxo-2-[[(2E,4E)-5-phenylpenta-2,4-dienoyl]amino]pentanoate |
|---|---|
| PubChem CID | 90424228 |
| Molecular Formula | C24H32N2O9 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | methyl 5-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methoxyoxan-3-yl]amino]-5-oxo-2-[[(2E,4E)-5-phenylpenta-2,4-dienoyl]amino]pentanoate |
| SMILES | COC(=O)C(CCC(=O)NC1C(OC)OC(CO)C(O)C1O)NC(=O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H32N2O9/c1-33-23(32)16(25-18(28)11-7-6-10-15-8-4-3-5-9-15)12-13-19(29)26-20-22(31)21(30)17(14-27)35-24(20)34-2/h3-11,16-17,20-22,24,27,30-31H,12-14H2,1-2H3,(H,25,28)(H,26,29)/b10-6+,11-7+ |
| InChIKey | DTUMMNZZUNCRJQ-JMQWPVDRSA-N |
| XLogP | -0.74 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|