C21H23N3O2 — CID 90439624
ethyl 3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]butanoate (PubChem CID 90439624) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is ethyl 3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]butanoate.
| Compound Name | ethyl 3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]butanoate |
|---|---|
| PubChem CID | 90439624 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl 3-[4-[1-(4-methylphenyl)-1,2,4-triazol-3-yl]phenyl]butanoate |
| SMILES | CCOC(=O)CC(C)c1ccc(-c2ncn(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-4-26-20(25)13-16(3)17-7-9-18(10-8-17)21-22-14-24(23-21)19-11-5-15(2)6-12-19/h5-12,14,16H,4,13H2,1-3H3 |
| InChIKey | MQEHJRZHFXTKQG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |