C11H23O2P — CID 90439954
(2R,3S,5S)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4,5-dimethyloxolan-3-ol (PubChem CID 90439954) has the molecular formula C11H23O2P and a molecular weight of 218.28 g/mol. Its IUPAC name is (2R,3S,5S)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4,5-dimethyloxolan-3-ol.
| Compound Name | (2R,3S,5S)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4,5-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 90439954 |
| Molecular Formula | C11H23O2P |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | (2R,3S,5S)-2-[2-[dimethyl(methylidene)-λ5-phosphanyl]ethyl]-4,5-dimethyloxolan-3-ol |
| SMILES | C=P(C)(C)CC[C@H]1O[C@@H](C)C(C)[C@@H]1O |
| InChI | InChI=1S/C11H23O2P/c1-8-9(2)13-10(11(8)12)6-7-14(3,4)5/h8-12H,3,6-7H2,1-2,4-5H3/t8?,9-,10+,11-/m0/s1 |
| InChIKey | DMRNYAXRHGTDFS-GYIHNLGQSA-N |
| XLogP | 1.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|