C42H59N2O6S2+ — CID 90439989
2-[2-[(3E)-2-tert-butyl-3-[(2E)-2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonic acid (PubChem CID 90439989) has the molecular formula C42H59N2O6S2+ and a molecular weight of 752.08 g/mol. Its IUPAC name is 2-[2-[(3E)-2-tert-butyl-3-[(2E)-2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonic acid.
| Compound Name | 2-[2-[(3E)-2-tert-butyl-3-[(2E)-2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonic acid |
|---|---|
| PubChem CID | 90439989 |
| Molecular Formula | C42H59N2O6S2+ |
| Molecular Weight | 752.08 g/mol |
| Exact Mass | 751.38 |
| IUPAC Name | 2-[2-[(3E)-2-tert-butyl-3-[(2E)-2-(1-butyl-3,3-dimethylindol-2-ylidene)ethylidene]cyclohexen-1-yl]ethyl]-3,3-dimethyl-1-(4-sulfobutyl)indol-1-ium-5-sulfonic acid |
| SMILES | CCCCN1/C(=C/C=C2\CCCC(CCC3=[N+](CCCCS(=O)(=O)O)c4ccc(S(=O)(=O)O)cc4C3(C)C)=C2C(C)(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C42H58N2O6S2/c1-9-10-26-43-35-19-12-11-18-33(35)41(5,6)37(43)24-20-30-16-15-17-31(39(30)40(2,3)4)21-25-38-42(7,8)34-29-32(52(48,49)50)22-23-36(34)44(38)27-13-14-28-51(45,46)47/h11-12,18-20,22-24,29H,9-10,13-17,21,25-28H2,1-8H3,(H-,45,46,47,48,49,50)/p+1/b30-20+,37-24+ |
| InChIKey | VZEMBYKNTAQGJU-QSZYDKDJSA-O |
| XLogP | 9.69 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.08 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|