C24H31F3N4O6Si — CID 90443415
1-[2-(1-hydroxycyclopropyl)ethyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90443415) has the molecular formula C24H31F3N4O6Si and a molecular weight of 556.61 g/mol. Its IUPAC name is 1-[2-(1-hydroxycyclopropyl)ethyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 1-[2-(1-hydroxycyclopropyl)ethyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90443415 |
| Molecular Formula | C24H31F3N4O6Si |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 1-[2-(1-hydroxycyclopropyl)ethyl]-3-methyl-8-[3-(trifluoromethoxy)phenoxy]-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)n(CCC2(O)CC2)c(=O)c2c1nc(Oc1cccc(OC(F)(F)F)c1)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H31F3N4O6Si/c1-29-19-18(20(32)30(22(29)33)11-10-23(34)8-9-23)31(15-35-12-13-38(2,3)4)21(28-19)36-16-6-5-7-17(14-16)37-24(25,26)27/h5-7,14,34H,8-13,15H2,1-4H3 |
| InChIKey | TXAZYGVFJYJXFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 109.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|