C9H13NO — CID 90443538
N-[(1E,3Z)-hexa-1,3,5-trienyl]propanamide (PubChem CID 90443538) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(1E,3Z)-hexa-1,3,5-trienyl]propanamide.
| Compound Name | N-[(1E,3Z)-hexa-1,3,5-trienyl]propanamide |
|---|---|
| PubChem CID | 90443538 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(1E,3Z)-hexa-1,3,5-trienyl]propanamide |
| SMILES | C=C/C=C\C=C\NC(=O)CC |
| InChI | InChI=1S/C9H13NO/c1-3-5-6-7-8-10-9(11)4-2/h3,5-8H,1,4H2,2H3,(H,10,11)/b6-5-,8-7+ |
| InChIKey | SBVIOBVUWIQJCC-IGTJQSIKSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|