C15H19NO — CID 90443549
(3E)-3-ethylidene-2-[(2E)-4-methoxy-2-methylpenta-2,4-dienyl]-4-methylidenepyridine (PubChem CID 90443549) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (3E)-3-ethylidene-2-[(2E)-4-methoxy-2-methylpenta-2,4-dienyl]-4-methylidenepyridine.
| Compound Name | (3E)-3-ethylidene-2-[(2E)-4-methoxy-2-methylpenta-2,4-dienyl]-4-methylidenepyridine |
|---|---|
| PubChem CID | 90443549 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (3E)-3-ethylidene-2-[(2E)-4-methoxy-2-methylpenta-2,4-dienyl]-4-methylidenepyridine |
| SMILES | C=C(/C=C(\C)Cc1nccc(=C)/c1=C\C)OC |
| InChI | InChI=1S/C15H19NO/c1-6-14-12(3)7-8-16-15(14)10-11(2)9-13(4)17-5/h6-9H,3-4,10H2,1-2,5H3/b11-9+,14-6+ |
| InChIKey | UQXNTJRTYQGAQZ-ZHWXPBBRSA-N |
| XLogP | 1.94 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|