C6H10F2O2 — CID 90449207
(5,5-difluorooxan-2-yl)methanol (PubChem CID 90449207) has the molecular formula C6H10F2O2 and a molecular weight of 152.14 g/mol. Its IUPAC name is (5,5-difluorooxan-2-yl)methanol.
| Compound Name | (5,5-difluorooxan-2-yl)methanol |
|---|---|
| PubChem CID | 90449207 |
| Molecular Formula | C6H10F2O2 |
| Molecular Weight | 152.14 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (5,5-difluorooxan-2-yl)methanol |
| SMILES | OCC1CCC(F)(F)CO1 |
| InChI | InChI=1S/C6H10F2O2/c7-6(8)2-1-5(3-9)10-4-6/h5,9H,1-4H2 |
| InChIKey | GTVDPLDACTYTLM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.14 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |