C11H19N3 — CID 90453694
(1Z,4Z)-N-ethyl-3-imino-N,2-dimethyl-1-(methylideneamino)hexa-1,4-dien-1-amine (PubChem CID 90453694) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (1Z,4Z)-N-ethyl-3-imino-N,2-dimethyl-1-(methylideneamino)hexa-1,4-dien-1-amine.
| Compound Name | (1Z,4Z)-N-ethyl-3-imino-N,2-dimethyl-1-(methylideneamino)hexa-1,4-dien-1-amine |
|---|---|
| PubChem CID | 90453694 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (1Z,4Z)-N-ethyl-3-imino-N,2-dimethyl-1-(methylideneamino)hexa-1,4-dien-1-amine |
| SMILES | [H]/N=C(\C=C/C)C(/C)=C(\N=C)N(C)CC |
| InChI | InChI=1S/C11H19N3/c1-6-8-10(12)9(3)11(13-4)14(5)7-2/h6,8,12H,4,7H2,1-3,5H3/b8-6-,11-9+,12-10+ |
| InChIKey | BENFIWCHALEGGK-BSPFAPSJSA-N |
| XLogP | 2.47 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|