C19H10F5N3O4 — CID 90459277
6-(3,5-difluorophenyl)-N-[3-nitro-4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 90459277) has the molecular formula C19H10F5N3O4 and a molecular weight of 439.30 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-N-[3-nitro-4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(3,5-difluorophenyl)-N-[3-nitro-4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90459277 |
| Molecular Formula | C19H10F5N3O4 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 6-(3,5-difluorophenyl)-N-[3-nitro-4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)c([N+](=O)[O-])c1)c1ccc(-c2cc(F)cc(F)c2)nc1 |
| InChI | InChI=1S/C19H10F5N3O4/c20-12-5-11(6-13(21)7-12)15-3-1-10(9-25-15)18(28)26-14-2-4-17(31-19(22,23)24)16(8-14)27(29)30/h1-9H,(H,26,28) |
| InChIKey | JIYHZXPYKBQYEF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|