C12H6F3N5O4 — CID 122150604
N-[3-cyano-4-(trifluoromethoxy)phenyl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 122150604) has the molecular formula C12H6F3N5O4 and a molecular weight of 341.21 g/mol. Its IUPAC name is N-[3-cyano-4-(trifluoromethoxy)phenyl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[3-cyano-4-(trifluoromethoxy)phenyl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 122150604 |
| Molecular Formula | C12H6F3N5O4 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[3-cyano-4-(trifluoromethoxy)phenyl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | N#Cc1cc(NC(=O)c2[nH]ncc2[N+](=O)[O-])ccc1OC(F)(F)F |
| InChI | InChI=1S/C12H6F3N5O4/c13-12(14,15)24-9-2-1-7(3-6(9)4-16)18-11(21)10-8(20(22)23)5-17-19-10/h1-3,5H,(H,17,19)(H,18,21) |
| InChIKey | VJMCCKFVKFSMMH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 133.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|