C16H15BrClNO3 — CID 90464830
1-[4-bromo-1-(4-chlorophenyl)butoxy]-3-nitrobenzene (PubChem CID 90464830) has the molecular formula C16H15BrClNO3 and a molecular weight of 384.66 g/mol. Its IUPAC name is 1-[4-bromo-1-(4-chlorophenyl)butoxy]-3-nitrobenzene.
| Compound Name | 1-[4-bromo-1-(4-chlorophenyl)butoxy]-3-nitrobenzene |
|---|---|
| PubChem CID | 90464830 |
| Molecular Formula | C16H15BrClNO3 |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 1-[4-bromo-1-(4-chlorophenyl)butoxy]-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(OC(CCCBr)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H15BrClNO3/c17-10-2-5-16(12-6-8-13(18)9-7-12)22-15-4-1-3-14(11-15)19(20)21/h1,3-4,6-9,11,16H,2,5,10H2 |
| InChIKey | OLACZOCQDCQEJG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|