C17H19ClN2O3 — CID 12874828
3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine (PubChem CID 12874828) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine.
| Compound Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine |
|---|---|
| PubChem CID | 12874828 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine |
| SMILES | CN(C)CCC(Oc1ccc([N+](=O)[O-])cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-19(2)12-11-17(13-3-5-14(18)6-4-13)23-16-9-7-15(8-10-16)20(21)22/h3-10,17H,11-12H2,1-2H3 |
| InChIKey | UGJMAQGLDKNWOQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|