C17H20Cl2N2O3 — CID 12874829
3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride (PubChem CID 12874829) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride.
| Compound Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 12874829 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dimethyl-3-(4-nitrophenoxy)propan-1-amine;hydrochloride |
| SMILES | CN(C)CCC(Oc1ccc([N+](=O)[O-])cc1)c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C17H19ClN2O3.ClH/c1-19(2)12-11-17(13-3-5-14(18)6-4-13)23-16-9-7-15(8-10-16)20(21)22;/h3-10,17H,11-12H2,1-2H3;1H |
| InChIKey | LNPUSOPLIIRANQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|