C16H13ClF3NO3 — CID 151737507
1-chloro-2-[4,4,4-trifluoro-1-(3-nitrophenoxy)butyl]benzene (PubChem CID 151737507) has the molecular formula C16H13ClF3NO3 and a molecular weight of 359.73 g/mol. Its IUPAC name is 1-chloro-2-[4,4,4-trifluoro-1-(3-nitrophenoxy)butyl]benzene.
| Compound Name | 1-chloro-2-[4,4,4-trifluoro-1-(3-nitrophenoxy)butyl]benzene |
|---|---|
| PubChem CID | 151737507 |
| Molecular Formula | C16H13ClF3NO3 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-chloro-2-[4,4,4-trifluoro-1-(3-nitrophenoxy)butyl]benzene |
| SMILES | O=[N+]([O-])c1cccc(OC(CCC(F)(F)F)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C16H13ClF3NO3/c17-14-7-2-1-6-13(14)15(8-9-16(18,19)20)24-12-5-3-4-11(10-12)21(22)23/h1-7,10,15H,8-9H2 |
| InChIKey | RLVKIWQGCGNNAX-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|