C24H26ClN7O — CID 90467635
8-(4-aminobutyl)-6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-2-(ethylamino)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 90467635) has the molecular formula C24H26ClN7O and a molecular weight of 463.97 g/mol. Its IUPAC name is 8-(4-aminobutyl)-6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-2-(ethylamino)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(4-aminobutyl)-6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-2-(ethylamino)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90467635 |
| Molecular Formula | C24H26ClN7O |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 8-(4-aminobutyl)-6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-2-(ethylamino)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCNc1ncc2cc(-c3ccc(-c4cncc(C)n4)cc3Cl)c(=O)n(CCCCN)c2n1 |
| InChI | InChI=1S/C24H26ClN7O/c1-3-28-24-29-13-17-10-19(23(33)32(22(17)31-24)9-5-4-8-26)18-7-6-16(11-20(18)25)21-14-27-12-15(2)30-21/h6-7,10-14H,3-5,8-9,26H2,1-2H3,(H,28,29,31) |
| InChIKey | QEFLWXKYNFVJSP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|