C31H44N2O16 — CID 90475749
(4R,4aR,7S,7aR,12bS)-3-methyl-9-(2-morpholin-4-ylethoxy)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;bis(2,3-dihydroxybutanedioic acid) (PubChem CID 90475749) has the molecular formula C31H44N2O16 and a molecular weight of 700.69 g/mol. Its IUPAC name is (4R,4aR,7S,7aR,12bS)-3-methyl-9-(2-morpholin-4-ylethoxy)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;bis(2,3-dihydroxybutanedioic acid).
| Compound Name | (4R,4aR,7S,7aR,12bS)-3-methyl-9-(2-morpholin-4-ylethoxy)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;bis(2,3-dihydroxybutanedioic acid) |
|---|---|
| PubChem CID | 90475749 |
| Molecular Formula | C31H44N2O16 |
| Molecular Weight | 700.69 g/mol |
| Exact Mass | 700.27 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-3-methyl-9-(2-morpholin-4-ylethoxy)-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol;bis(2,3-dihydroxybutanedioic acid) |
| SMILES | CN1CC[C@]23c4c5ccc(OCCN6CCOCC6)c4O[C@H]2[C@@H](O)CC[C@H]3[C@H]1C5.O=C(O)C(O)C(O)C(=O)O.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C23H32N2O4.2C4H6O6/c1-24-7-6-23-16-3-4-18(26)22(23)29-21-19(5-2-15(20(21)23)14-17(16)24)28-13-10-25-8-11-27-12-9-25;2*5-1(3(7)8)2(6)4(9)10/h2,5,16-18,22,26H,3-4,6-14H2,1H3;2*1-2,5-6H,(H,7,8)(H,9,10)/t16-,17+,18-,22-,23-;;/m0../s1 |
| InChIKey | JGARUPJPIFMHAX-GLIKYNQJSA-N |
| XLogP | -2.82 |
| TPSA | 284.52 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.69 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |