C20H35N3O5 — CID 90485246
N-[[4-(dimethylamino)phenyl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine;oxalic acid;hydrate (PubChem CID 90485246) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine;oxalic acid;hydrate.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine;oxalic acid;hydrate |
|---|---|
| PubChem CID | 90485246 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2,2,6,6-tetramethylpiperidin-4-amine;oxalic acid;hydrate |
| SMILES | CN(C)c1ccc(CNC2CC(C)(C)NC(C)(C)C2)cc1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H31N3.C2H2O4.H2O/c1-17(2)11-15(12-18(3,4)20-17)19-13-14-7-9-16(10-8-14)21(5)6;3-1(4)2(5)6;/h7-10,15,19-20H,11-13H2,1-6H3;(H,3,4)(H,5,6);1H2 |
| InChIKey | CQAXJOGTBRCBDP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|