C25H21BrN2O4S — CID 90486508
6-(4-hydroxy-3-methoxyphenyl)-2-phenacylsulfanyl-3-phenylpyrimidin-4-one;hydrobromide (PubChem CID 90486508) has the molecular formula C25H21BrN2O4S and a molecular weight of 525.42 g/mol. Its IUPAC name is 6-(4-hydroxy-3-methoxyphenyl)-2-phenacylsulfanyl-3-phenylpyrimidin-4-one;hydrobromide.
| Compound Name | 6-(4-hydroxy-3-methoxyphenyl)-2-phenacylsulfanyl-3-phenylpyrimidin-4-one;hydrobromide |
|---|---|
| PubChem CID | 90486508 |
| Molecular Formula | C25H21BrN2O4S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 6-(4-hydroxy-3-methoxyphenyl)-2-phenacylsulfanyl-3-phenylpyrimidin-4-one;hydrobromide |
| SMILES | Br.COc1cc(-c2cc(=O)n(-c3ccccc3)c(SCC(=O)c3ccccc3)n2)ccc1O |
| InChI | InChI=1S/C25H20N2O4S.BrH/c1-31-23-14-18(12-13-21(23)28)20-15-24(30)27(19-10-6-3-7-11-19)25(26-20)32-16-22(29)17-8-4-2-5-9-17;/h2-15,28H,16H2,1H3;1H |
| InChIKey | SMDUTVVXZUAXLF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |