C22H19N2O3+ — CID 90486695
1-(3,4-dimethoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone (PubChem CID 90486695) has the molecular formula C22H19N2O3+ and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 90486695 |
| Molecular Formula | C22H19N2O3+ |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-(1,10-phenanthrolin-1-ium-1-yl)ethanone |
| SMILES | COc1ccc(C(=O)C[n+]2cccc3ccc4cccnc4c32)cc1OC |
| InChI | InChI=1S/C22H19N2O3/c1-26-19-10-9-17(13-20(19)27-2)18(25)14-24-12-4-6-16-8-7-15-5-3-11-23-21(15)22(16)24/h3-13H,14H2,1-2H3/q+1 |
| InChIKey | UTFGWHPDTZJRBW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|