C14H9BrClN5O — CID 90486810
5-bromo-N-[(E)-(4-chlorophenyl)methylideneamino]imidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 90486810) has the molecular formula C14H9BrClN5O and a molecular weight of 378.62 g/mol. Its IUPAC name is 5-bromo-N-[(E)-(4-chlorophenyl)methylideneamino]imidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | 5-bromo-N-[(E)-(4-chlorophenyl)methylideneamino]imidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90486810 |
| Molecular Formula | C14H9BrClN5O |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | 5-bromo-N-[(E)-(4-chlorophenyl)methylideneamino]imidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)c1cn2c(Br)cncc2n1 |
| InChI | InChI=1S/C14H9BrClN5O/c15-12-6-17-7-13-19-11(8-21(12)13)14(22)20-18-5-9-1-3-10(16)4-2-9/h1-8H,(H,20,22)/b18-5+ |
| InChIKey | YBHXDXFAZIWRGN-BLLMUTORSA-N |
| XLogP | 2.91 |
| TPSA | 71.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|