C19H16BrCl2N5O — CID 11070888
N-[(E)-(4-bromophenyl)methylideneamino]-5-chloro-1-(4-chlorophenyl)-2-(dimethylamino)imidazole-4-carboxamide (PubChem CID 11070888) has the molecular formula C19H16BrCl2N5O and a molecular weight of 481.18 g/mol. Its IUPAC name is N-[(E)-(4-bromophenyl)methylideneamino]-5-chloro-1-(4-chlorophenyl)-2-(dimethylamino)imidazole-4-carboxamide.
| Compound Name | N-[(E)-(4-bromophenyl)methylideneamino]-5-chloro-1-(4-chlorophenyl)-2-(dimethylamino)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 11070888 |
| Molecular Formula | C19H16BrCl2N5O |
| Molecular Weight | 481.18 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | N-[(E)-(4-bromophenyl)methylideneamino]-5-chloro-1-(4-chlorophenyl)-2-(dimethylamino)imidazole-4-carboxamide |
| SMILES | CN(C)c1nc(C(=O)N/N=C/c2ccc(Br)cc2)c(Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16BrCl2N5O/c1-26(2)19-24-16(17(22)27(19)15-9-7-14(21)8-10-15)18(28)25-23-11-12-3-5-13(20)6-4-12/h3-11H,1-2H3,(H,25,28)/b23-11+ |
| InChIKey | OTRVRIHFOAOFKY-FOKLQQMPSA-N |
| XLogP | 4.77 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|