C25H25N3O2S — CID 90494567
1-naphthalen-2-ylsulfonyl-4-[(2-phenylimidazol-1-yl)methyl]piperidine (PubChem CID 90494567) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-naphthalen-2-ylsulfonyl-4-[(2-phenylimidazol-1-yl)methyl]piperidine.
| Compound Name | 1-naphthalen-2-ylsulfonyl-4-[(2-phenylimidazol-1-yl)methyl]piperidine |
|---|---|
| PubChem CID | 90494567 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-naphthalen-2-ylsulfonyl-4-[(2-phenylimidazol-1-yl)methyl]piperidine |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCC(Cn2ccnc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3O2S/c29-31(30,24-11-10-21-6-4-5-9-23(21)18-24)28-15-12-20(13-16-28)19-27-17-14-26-25(27)22-7-2-1-3-8-22/h1-11,14,17-18,20H,12-13,15-16,19H2 |
| InChIKey | LKPBISLYIGYXKV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |