C18H29NO4S — CID 90498901
N-(2-cyclohexyl-2-hydroxyethyl)-3-methyl-4-propoxybenzenesulfonamide (PubChem CID 90498901) has the molecular formula C18H29NO4S and a molecular weight of 355.50 g/mol. Its IUPAC name is N-(2-cyclohexyl-2-hydroxyethyl)-3-methyl-4-propoxybenzenesulfonamide.
| Compound Name | N-(2-cyclohexyl-2-hydroxyethyl)-3-methyl-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90498901 |
| Molecular Formula | C18H29NO4S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-(2-cyclohexyl-2-hydroxyethyl)-3-methyl-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)NCC(O)C2CCCCC2)cc1C |
| InChI | InChI=1S/C18H29NO4S/c1-3-11-23-18-10-9-16(12-14(18)2)24(21,22)19-13-17(20)15-7-5-4-6-8-15/h9-10,12,15,17,19-20H,3-8,11,13H2,1-2H3 |
| InChIKey | QUJHFPCKSAMPMP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |