C19H24N2O4S2 — CID 90499866
N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 90499866) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 90499866 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-2-ylpropyl)-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC(O)(CNC(=O)c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-19(23,17-6-5-13-26-17)14-20-18(22)15-7-9-16(10-8-15)27(24,25)21-11-3-2-4-12-21/h5-10,13,23H,2-4,11-12,14H2,1H3,(H,20,22) |
| InChIKey | WFDSIXWAXFBIPU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |