C14H18ClNO3S2 — CID 90510737
8-(3-chloro-4-methylphenyl)sulfonyl-1-oxa-4-thia-8-azaspiro[4.5]decane (PubChem CID 90510737) has the molecular formula C14H18ClNO3S2 and a molecular weight of 347.89 g/mol. Its IUPAC name is 8-(3-chloro-4-methylphenyl)sulfonyl-1-oxa-4-thia-8-azaspiro[4.5]decane.
| Compound Name | 8-(3-chloro-4-methylphenyl)sulfonyl-1-oxa-4-thia-8-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 90510737 |
| Molecular Formula | C14H18ClNO3S2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 8-(3-chloro-4-methylphenyl)sulfonyl-1-oxa-4-thia-8-azaspiro[4.5]decane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC3(CC2)OCCS3)cc1Cl |
| InChI | InChI=1S/C14H18ClNO3S2/c1-11-2-3-12(10-13(11)15)21(17,18)16-6-4-14(5-7-16)19-8-9-20-14/h2-3,10H,4-9H2,1H3 |
| InChIKey | UEYLQTVZPQEBOM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |