C14H12FN3O3S2 — CID 90518643
N-(2,1,3-benzothiadiazol-4-yl)-2-(4-fluorophenoxy)ethanesulfonamide (PubChem CID 90518643) has the molecular formula C14H12FN3O3S2 and a molecular weight of 353.40 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-2-(4-fluorophenoxy)ethanesulfonamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(4-fluorophenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 90518643 |
| Molecular Formula | C14H12FN3O3S2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-2-(4-fluorophenoxy)ethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccc(F)cc1)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C14H12FN3O3S2/c15-10-4-6-11(7-5-10)21-8-9-23(19,20)18-13-3-1-2-12-14(13)17-22-16-12/h1-7,18H,8-9H2 |
| InChIKey | BCBPCKXRDGMKJC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |