C24H29NO2 — CID 90524399
N-(3-hydroxy-3-naphthalen-1-ylpropyl)adamantane-1-carboxamide (PubChem CID 90524399) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is N-(3-hydroxy-3-naphthalen-1-ylpropyl)adamantane-1-carboxamide.
| Compound Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 90524399 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | N-(3-hydroxy-3-naphthalen-1-ylpropyl)adamantane-1-carboxamide |
| SMILES | O=C(NCCC(O)c1cccc2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H29NO2/c26-22(21-7-3-5-19-4-1-2-6-20(19)21)8-9-25-23(27)24-13-16-10-17(14-24)12-18(11-16)15-24/h1-7,16-18,22,26H,8-15H2,(H,25,27) |
| InChIKey | CWVNHJCZTSVAPP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |