C20H28N4OS — CID 90533837
[4-[2-(2-methylimidazol-1-yl)ethyl]piperazin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone (PubChem CID 90533837) has the molecular formula C20H28N4OS and a molecular weight of 372.54 g/mol. Its IUPAC name is [4-[2-(2-methylimidazol-1-yl)ethyl]piperazin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone.
| Compound Name | [4-[2-(2-methylimidazol-1-yl)ethyl]piperazin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone |
|---|---|
| PubChem CID | 90533837 |
| Molecular Formula | C20H28N4OS |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [4-[2-(2-methylimidazol-1-yl)ethyl]piperazin-1-yl]-(1-thiophen-2-ylcyclopentyl)methanone |
| SMILES | Cc1nccn1CCN1CCN(C(=O)C2(c3cccs3)CCCC2)CC1 |
| InChI | InChI=1S/C20H28N4OS/c1-17-21-8-9-23(17)13-10-22-11-14-24(15-12-22)19(25)20(6-2-3-7-20)18-5-4-16-26-18/h4-5,8-9,16H,2-3,6-7,10-15H2,1H3 |
| InChIKey | JMRZIDGOOGIONQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |