C16H15ClF3NO3S — CID 90534838
5-chloro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methylbenzenesulfonamide (PubChem CID 90534838) has the molecular formula C16H15ClF3NO3S and a molecular weight of 393.81 g/mol. Its IUPAC name is 5-chloro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-chloro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90534838 |
| Molecular Formula | C16H15ClF3NO3S |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 5-chloro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(Cl)cc1S(=O)(=O)NCC(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15ClF3NO3S/c1-10-2-7-13(17)8-15(10)25(23,24)21-9-14(22)11-3-5-12(6-4-11)16(18,19)20/h2-8,14,21-22H,9H2,1H3 |
| InChIKey | BCTQGGOFHKSTCJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |