C19H28N2O4 — CID 90536592
N'-cyclohexyl-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]oxamide (PubChem CID 90536592) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N'-cyclohexyl-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 90536592 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N'-cyclohexyl-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]oxamide |
| SMILES | Cc1ccc(C(CNC(=O)C(=O)NC2CCCCC2)OCCO)cc1 |
| InChI | InChI=1S/C19H28N2O4/c1-14-7-9-15(10-8-14)17(25-12-11-22)13-20-18(23)19(24)21-16-5-3-2-4-6-16/h7-10,16-17,22H,2-6,11-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | WKMANCVUMXJREC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|