C19H19ClFNO4S — CID 90591730
(2-chloro-6-fluorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]methanone (PubChem CID 90591730) has the molecular formula C19H19ClFNO4S and a molecular weight of 411.88 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90591730 |
| Molecular Formula | C19H19ClFNO4S |
| Molecular Weight | 411.88 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[4-(4-methoxyphenyl)sulfonylpiperidin-1-yl]methanone |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(C(=O)c3c(F)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C19H19ClFNO4S/c1-26-13-5-7-14(8-6-13)27(24,25)15-9-11-22(12-10-15)19(23)18-16(20)3-2-4-17(18)21/h2-8,15H,9-12H2,1H3 |
| InChIKey | YJWRRTGLDPUGDK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |