C19H16ClN3O3S — CID 90594997
[3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone (PubChem CID 90594997) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is [3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone.
| Compound Name | [3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone |
|---|---|
| PubChem CID | 90594997 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [3-(4-chlorophenyl)sulfonylazetidin-1-yl]-(3-phenyl-1H-pyrazol-5-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)N1CC(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C19H16ClN3O3S/c20-14-6-8-15(9-7-14)27(25,26)16-11-23(12-16)19(24)18-10-17(21-22-18)13-4-2-1-3-5-13/h1-10,16H,11-12H2,(H,21,22) |
| InChIKey | NRAFTMYRQUAOOI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |