C20H20N4O3S — CID 9059948
N'-[(2S)-2-[[1-(4-methylphenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]propanoyl]benzohydrazide (PubChem CID 9059948) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is N'-[(2S)-2-[[1-(4-methylphenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2S)-2-[[1-(4-methylphenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9059948 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N'-[(2S)-2-[[1-(4-methylphenyl)-5-oxo-4H-imidazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
| SMILES | Cc1ccc(N2C(=O)CN=C2S[C@@H](C)C(=O)NNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H20N4O3S/c1-13-8-10-16(11-9-13)24-17(25)12-21-20(24)28-14(2)18(26)22-23-19(27)15-6-4-3-5-7-15/h3-11,14H,12H2,1-2H3,(H,22,26)(H,23,27)/t14-/m0/s1 |
| InChIKey | BYMAINBFTLTUJS-AWEZNQCLSA-N |
| XLogP | 2.28 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|