C19H14N2O5S2 — CID 90613246
N-[(5-benzoylthiophen-2-yl)methyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide (PubChem CID 90613246) has the molecular formula C19H14N2O5S2 and a molecular weight of 414.46 g/mol. Its IUPAC name is N-[(5-benzoylthiophen-2-yl)methyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide.
| Compound Name | N-[(5-benzoylthiophen-2-yl)methyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 90613246 |
| Molecular Formula | C19H14N2O5S2 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | N-[(5-benzoylthiophen-2-yl)methyl]-2-oxo-3H-1,3-benzoxazole-5-sulfonamide |
| SMILES | O=C(c1ccccc1)c1ccc(CNS(=O)(=O)c2ccc3oc(=O)[nH]c3c2)s1 |
| InChI | InChI=1S/C19H14N2O5S2/c22-18(12-4-2-1-3-5-12)17-9-6-13(27-17)11-20-28(24,25)14-7-8-16-15(10-14)21-19(23)26-16/h1-10,20H,11H2,(H,21,23) |
| InChIKey | QYPXUBPFXOIYKV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |