C14H16N4O5S — CID 90615344
N-[2-(6,7-dihydro-4H-pyrano[3,4-d]pyrazol-1-yl)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 90615344) has the molecular formula C14H16N4O5S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-[2-(6,7-dihydro-4H-pyrano[3,4-d]pyrazol-1-yl)ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(6,7-dihydro-4H-pyrano[3,4-d]pyrazol-1-yl)ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90615344 |
| Molecular Formula | C14H16N4O5S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[2-(6,7-dihydro-4H-pyrano[3,4-d]pyrazol-1-yl)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)NCCn1ncc2c1CCOC2 |
| InChI | InChI=1S/C14H16N4O5S/c19-18(20)13-3-1-2-4-14(13)24(21,22)16-6-7-17-12-5-8-23-10-11(12)9-15-17/h1-4,9,16H,5-8,10H2 |
| InChIKey | BTXLVCIDGDMAIK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|