C11H14N4O5S — CID 715060
2-nitro-N-[2-(2-oxoimidazolidin-1-yl)ethyl]benzenesulfonamide (PubChem CID 715060) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is 2-nitro-N-[2-(2-oxoimidazolidin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-nitro-N-[2-(2-oxoimidazolidin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 715060 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-nitro-N-[2-(2-oxoimidazolidin-1-yl)ethyl]benzenesulfonamide |
| SMILES | O=C1NCCN1CCNS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O5S/c16-11-12-5-7-14(11)8-6-13-21(19,20)10-4-2-1-3-9(10)15(17)18/h1-4,13H,5-8H2,(H,12,16) |
| InChIKey | DQBDDUAIBWTFOX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|