C13H13N3O6S — CID 161313556
N-[2-(2,4-dioxo-1-pyridinyl)ethyl]-2-nitrobenzenesulfonamide (PubChem CID 161313556) has the molecular formula C13H13N3O6S and a molecular weight of 339.33 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1-pyridinyl)ethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(2,4-dioxo-1-pyridinyl)ethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 161313556 |
| Molecular Formula | C13H13N3O6S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | N-[2-(2,4-dioxo-1-pyridinyl)ethyl]-2-nitrobenzenesulfonamide |
| SMILES | O=C1C=CN(CCNS(=O)(=O)c2ccccc2[N+](=O)[O-])C(=O)C1 |
| InChI | InChI=1S/C13H13N3O6S/c17-10-5-7-15(13(18)9-10)8-6-14-23(21,22)12-4-2-1-3-11(12)16(19)20/h1-5,7,14H,6,8-9H2 |
| InChIKey | VJFAELRURKLUQY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|