C16H21NO4S — CID 90618746
1'-butylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 90618746) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is 1'-butylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | 1'-butylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 90618746 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1'-butylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | CCCCS(=O)(=O)N1CCCC2(C1)OC(=O)c1ccccc12 |
| InChI | InChI=1S/C16H21NO4S/c1-2-3-11-22(19,20)17-10-6-9-16(12-17)14-8-5-4-7-13(14)15(18)21-16/h4-5,7-8H,2-3,6,9-12H2,1H3 |
| InChIKey | XNHSWUMCCRWLFO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |