C13H17N3O4 — CID 90624780
N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 90624780) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90624780 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)NCC(O)Cn2ccccc2=O)N1 |
| InChI | InChI=1S/C13H17N3O4/c17-9(8-16-6-2-1-3-12(16)19)7-14-13(20)10-4-5-11(18)15-10/h1-3,6,9-10,17H,4-5,7-8H2,(H,14,20)(H,15,18) |
| InChIKey | RSBGZQKIEPGDOE-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |