C16H23N3O4 — CID 90624817
1-acetyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]piperidine-4-carboxamide (PubChem CID 90624817) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-acetyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90624817 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 1-acetyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCC(O)Cn2ccccc2=O)CC1 |
| InChI | InChI=1S/C16H23N3O4/c1-12(20)18-8-5-13(6-9-18)16(23)17-10-14(21)11-19-7-3-2-4-15(19)22/h2-4,7,13-14,21H,5-6,8-11H2,1H3,(H,17,23) |
| InChIKey | COGHDVLNVALVNM-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |