C15H20N4O5 — CID 90625137
4-ethyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-2,3-dioxopiperazine-1-carboxamide (PubChem CID 90625137) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-ethyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-2,3-dioxopiperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-2,3-dioxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 90625137 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 4-ethyl-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-2,3-dioxopiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NCC(O)Cn2ccccc2=O)C(=O)C1=O |
| InChI | InChI=1S/C15H20N4O5/c1-2-17-7-8-19(14(23)13(17)22)15(24)16-9-11(20)10-18-6-4-3-5-12(18)21/h3-6,11,20H,2,7-10H2,1H3,(H,16,24) |
| InChIKey | RBUHEKSXVLDABC-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|