C17H17N3O5 — CID 90624946
(E)-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 90624946) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is (E)-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 90624946 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | (E)-N-[2-hydroxy-3-(2-oxo-1-pyridinyl)propyl]-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCC(O)Cn1ccccc1=O |
| InChI | InChI=1S/C17H17N3O5/c21-15(12-19-10-2-1-3-17(19)23)11-18-16(22)9-6-13-4-7-14(8-5-13)20(24)25/h1-10,15,21H,11-12H2,(H,18,22)/b9-6+ |
| InChIKey | LRYPXDUXIFCSIX-RMKNXTFCSA-N |
| XLogP | 0.95 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|